C29H37F3N6O3 — CID 169428842
(2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[2-methyl-7-(trifluoromethyl)quinazolin-4-yl]amino]butanoic acid (PubChem CID 169428842) has the molecular formula C29H37F3N6O3 and a molecular weight of 574.65 g/mol. Its IUPAC name is (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[2-methyl-7-(trifluoromethyl)quinazolin-4-yl]amino]butanoic acid.
| Compound Name | (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[2-methyl-7-(trifluoromethyl)quinazolin-4-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 169428842 |
| Molecular Formula | C29H37F3N6O3 |
| Molecular Weight | 574.65 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[2-methyl-7-(trifluoromethyl)quinazolin-4-yl]amino]butanoic acid |
| SMILES | COCCN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](Nc1nc(C)nc2cc(C(F)(F)F)ccc12)C(=O)O |
| InChI | InChI=1S/C29H37F3N6O3/c1-19-34-25-18-21(29(30,31)32)9-11-23(25)27(35-19)37-24(28(39)40)12-15-38(16-17-41-2)14-4-3-7-22-10-8-20-6-5-13-33-26(20)36-22/h8-11,18,24H,3-7,12-17H2,1-2H3,(H,33,36)(H,39,40)(H,34,35,37)/t24-/m0/s1 |
| InChIKey | QUBMDZKYIXZDFZ-DEOSSOPVSA-N |
| XLogP | 4.94 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.65 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|