C26H36F2N6O2 — CID 169428845
(2S)-2-[(2-cyclopropylpyrimidin-4-yl)amino]-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 169428845) has the molecular formula C26H36F2N6O2 and a molecular weight of 502.61 g/mol. Its IUPAC name is (2S)-2-[(2-cyclopropylpyrimidin-4-yl)amino]-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | (2S)-2-[(2-cyclopropylpyrimidin-4-yl)amino]-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 169428845 |
| Molecular Formula | C26H36F2N6O2 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | (2S)-2-[(2-cyclopropylpyrimidin-4-yl)amino]-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCC(F)F)Nc1ccnc(C2CC2)n1 |
| InChI | InChI=1S/C26H36F2N6O2/c27-22(28)12-17-34(15-2-1-5-20-9-8-18-4-3-13-29-24(18)31-20)16-11-21(26(35)36)32-23-10-14-30-25(33-23)19-6-7-19/h8-10,14,19,21-22H,1-7,11-13,15-17H2,(H,29,31)(H,35,36)(H,30,32,33)/t21-/m0/s1 |
| InChIKey | YVJXZFVLVKSWNA-NRFANRHFSA-N |
| XLogP | 4.34 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|