C20H21F4N5O2 — CID 169429063
1,1,1-trifluoro-2-[3-[6-[[(3R,4R)-4-fluoropyrrolidin-3-yl]amino]-2-pyridinyl]-7-(hydroxymethyl)imidazo[1,2-a]pyridin-6-yl]propan-2-ol (PubChem CID 169429063) has the molecular formula C20H21F4N5O2 and a molecular weight of 439.41 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[3-[6-[[(3R,4R)-4-fluoropyrrolidin-3-yl]amino]-2-pyridinyl]-7-(hydroxymethyl)imidazo[1,2-a]pyridin-6-yl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[3-[6-[[(3R,4R)-4-fluoropyrrolidin-3-yl]amino]-2-pyridinyl]-7-(hydroxymethyl)imidazo[1,2-a]pyridin-6-yl]propan-2-ol |
|---|---|
| PubChem CID | 169429063 |
| Molecular Formula | C20H21F4N5O2 |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1,1,1-trifluoro-2-[3-[6-[[(3R,4R)-4-fluoropyrrolidin-3-yl]amino]-2-pyridinyl]-7-(hydroxymethyl)imidazo[1,2-a]pyridin-6-yl]propan-2-ol |
| SMILES | CC(O)(c1cn2c(-c3cccc(N[C@@H]4CNC[C@H]4F)n3)cnc2cc1CO)C(F)(F)F |
| InChI | InChI=1S/C20H21F4N5O2/c1-19(31,20(22,23)24)12-9-29-16(8-26-18(29)5-11(12)10-30)14-3-2-4-17(27-14)28-15-7-25-6-13(15)21/h2-5,8-9,13,15,25,30-31H,6-7,10H2,1H3,(H,27,28)/t13-,15-,19?/m1/s1 |
| InChIKey | XBMMPGPTZWUPAP-PIAVTGDYSA-N |
| XLogP | 2.38 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |