C17H27N3O — CID 169429292
(E)-3-(dimethylamino)-1-(2-methylpyrazolo[1,5-a]pyridin-3-yl)prop-2-en-1-one;ethane (PubChem CID 169429292) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-1-(2-methylpyrazolo[1,5-a]pyridin-3-yl)prop-2-en-1-one;ethane.
| Compound Name | (E)-3-(dimethylamino)-1-(2-methylpyrazolo[1,5-a]pyridin-3-yl)prop-2-en-1-one;ethane |
|---|---|
| PubChem CID | 169429292 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | (E)-3-(dimethylamino)-1-(2-methylpyrazolo[1,5-a]pyridin-3-yl)prop-2-en-1-one;ethane |
| SMILES | CC.CC.Cc1nn2ccccc2c1C(=O)/C=C/N(C)C |
| InChI | InChI=1S/C13H15N3O.2C2H6/c1-10-13(12(17)7-9-15(2)3)11-6-4-5-8-16(11)14-10;2*1-2/h4-9H,1-3H3;2*1-2H3/b9-7+;; |
| InChIKey | QTFKNLBOURSMAD-OJYIHNBOSA-N |
| XLogP | 3.95 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|