C20H27F3N4O7S2 — CID 169430616
N-hydroxy-4-[4-(5-pent-1-ynyl-1,3-thiazol-2-yl)piperazin-1-yl]sulfonyloxane-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 169430616) has the molecular formula C20H27F3N4O7S2 and a molecular weight of 556.59 g/mol. Its IUPAC name is N-hydroxy-4-[4-(5-pent-1-ynyl-1,3-thiazol-2-yl)piperazin-1-yl]sulfonyloxane-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-hydroxy-4-[4-(5-pent-1-ynyl-1,3-thiazol-2-yl)piperazin-1-yl]sulfonyloxane-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 169430616 |
| Molecular Formula | C20H27F3N4O7S2 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | N-hydroxy-4-[4-(5-pent-1-ynyl-1,3-thiazol-2-yl)piperazin-1-yl]sulfonyloxane-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCC#Cc1cnc(N2CCN(S(=O)(=O)C3(C(=O)NO)CCOCC3)CC2)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N4O5S2.C2HF3O2/c1-2-3-4-5-15-14-19-17(28-15)21-8-10-22(11-9-21)29(25,26)18(16(23)20-24)6-12-27-13-7-18;3-2(4,5)1(6)7/h14,24H,2-3,6-13H2,1H3,(H,20,23);(H,6,7) |
| InChIKey | BGXGGFHIBICWAF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 149.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|