About 1-bromoundec-10-enyl benzoate
1-bromoundec-10-enyl benzoate (PubChem CID 169432361) has the molecular formula C18H25BrO2
and a molecular weight of 353.30 g/mol. Its IUPAC name is 1-bromoundec-10-enyl benzoate.
Molecular Properties
| Compound Name | 1-bromoundec-10-enyl benzoate |
| PubChem CID | 169432361 |
| Molecular Formula | C18H25BrO2 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1-bromoundec-10-enyl benzoate |
| SMILES | C=CCCCCCCCCC(Br)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H25BrO2/c1-2-3-4-5-6-7-8-12-15-17(19)21-18(20)16-13-10-9-11-14-16/h2,9-11,13-14,17H,1,3-8,12,15H2 |
| InChIKey | YSQSPPSAIAYGHD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-bromoundec-10-enyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromoundec-10-enyl benzoate?
The IUPAC name of 1-bromoundec-10-enyl benzoate (CID 169432361) is 1-bromoundec-10-enyl benzoate.
What is the SMILES notation for 1-bromoundec-10-enyl benzoate?
The canonical SMILES for 1-bromoundec-10-enyl benzoate is C=CCCCCCCCCC(Br)OC(=O)c1ccccc1.
What is the InChIKey of 1-bromoundec-10-enyl benzoate?
The InChIKey is YSQSPPSAIAYGHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25BrO2/c1-2-3-4-5-6-7-8-12-15-17(19)21-18(20)16-13-10-9-11-14-16/h2,9-11,13-14,17H,1,3-8,12,15H2.
What are the key properties of 1-bromoundec-10-enyl benzoate?
1-bromoundec-10-enyl benzoate has a molecular weight of 353.30 g/mol, XLogP of 5.87, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromoundec-10-enyl benzoate is sourced from PubChem (CID 169432361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).