C20H28N2O5 — CID 169432373
2-(2-methyl-1-octoxypropan-2-yl)-6-nitro-3,1-benzoxazin-4-one (PubChem CID 169432373) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-(2-methyl-1-octoxypropan-2-yl)-6-nitro-3,1-benzoxazin-4-one.
| Compound Name | 2-(2-methyl-1-octoxypropan-2-yl)-6-nitro-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 169432373 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-(2-methyl-1-octoxypropan-2-yl)-6-nitro-3,1-benzoxazin-4-one |
| SMILES | CCCCCCCCOCC(C)(C)c1nc2ccc([N+](=O)[O-])cc2c(=O)o1 |
| InChI | InChI=1S/C20H28N2O5/c1-4-5-6-7-8-9-12-26-14-20(2,3)19-21-17-11-10-15(22(24)25)13-16(17)18(23)27-19/h10-11,13H,4-9,12,14H2,1-3H3 |
| InChIKey | YVTWMNPZZASQBI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|