C6H7ClO3 — CID 169432612
3-acetyl-3-chloro(2,3-13C2)oxolan-2-one (PubChem CID 169432612) has the molecular formula C6H7ClO3 and a molecular weight of 166.54 g/mol. Its IUPAC name is 3-acetyl-3-chloro(2,3-13C2)oxolan-2-one.
| Compound Name | 3-acetyl-3-chloro(2,3-13C2)oxolan-2-one |
|---|---|
| PubChem CID | 169432612 |
| Molecular Formula | C6H7ClO3 |
| Molecular Weight | 166.54 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 3-acetyl-3-chloro(2,3-13C2)oxolan-2-one |
| SMILES | [13CH3][13C](=O)[13C]1(Cl)CCO[13C]1=O |
| InChI | InChI=1S/C6H7ClO3/c1-4(8)6(7)2-3-10-5(6)9/h2-3H2,1H3/i1+1,4+1,5+1,6+1 |
| InChIKey | CYCRRRIREKXQTK-WMPIHMMDSA-N |
| XLogP | 0.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.54 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|