C12H22N2 — CID 169432790
N-(2-adamantyl)-1,1,2,2-tetradeuterioethane-1,2-diamine (PubChem CID 169432790) has the molecular formula C12H22N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is N-(2-adamantyl)-1,1,2,2-tetradeuterioethane-1,2-diamine.
| Compound Name | N-(2-adamantyl)-1,1,2,2-tetradeuterioethane-1,2-diamine |
|---|---|
| PubChem CID | 169432790 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | N-(2-adamantyl)-1,1,2,2-tetradeuterioethane-1,2-diamine |
| SMILES | [2H]C([2H])(N)C([2H])([2H])NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C12H22N2/c13-1-2-14-12-10-4-8-3-9(6-10)7-11(12)5-8/h8-12,14H,1-7,13H2/i1D2,2D2 |
| InChIKey | LSZAYCTUPPKNOV-LNLMKGTHSA-N |
| XLogP | 1.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |