C6H7NO — CID 169433284
3-amino-2,4,5,6-tetradeuteriophenol (PubChem CID 169433284) has the molecular formula C6H7NO and a molecular weight of 113.15 g/mol. Its IUPAC name is 3-amino-2,4,5,6-tetradeuteriophenol.
| Compound Name | 3-amino-2,4,5,6-tetradeuteriophenol |
|---|---|
| PubChem CID | 169433284 |
| Molecular Formula | C6H7NO |
| Molecular Weight | 113.15 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 3-amino-2,4,5,6-tetradeuteriophenol |
| SMILES | [2H]c1c([2H])c(N)c([2H])c(O)c1[2H] |
| InChI | InChI=1S/C6H7NO/c7-5-2-1-3-6(8)4-5/h1-4,8H,7H2/i1D,2D,3D,4D |
| InChIKey | CWLKGDAVCFYWJK-RHQRLBAQSA-N |
| XLogP | 0.97 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.15 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|