C23H27N3O2 — CID 169433876
1-[(6aR,9R)-9-[(2S,4S)-2,4-dimethylazetidine-1-carbonyl]-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]ethanone (PubChem CID 169433876) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[(6aR,9R)-9-[(2S,4S)-2,4-dimethylazetidine-1-carbonyl]-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]ethanone.
| Compound Name | 1-[(6aR,9R)-9-[(2S,4S)-2,4-dimethylazetidine-1-carbonyl]-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]ethanone |
|---|---|
| PubChem CID | 169433876 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-[(6aR,9R)-9-[(2S,4S)-2,4-dimethylazetidine-1-carbonyl]-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]ethanone |
| SMILES | CC(=O)n1cc2c3c(cccc31)C1=C[C@@H](C(=O)N3[C@@H](C)C[C@@H]3C)CN(C)[C@@H]1C2 |
| InChI | InChI=1S/C23H27N3O2/c1-13-8-14(2)26(13)23(28)17-9-19-18-6-5-7-20-22(18)16(12-25(20)15(3)27)10-21(19)24(4)11-17/h5-7,9,12-14,17,21H,8,10-11H2,1-4H3/t13-,14-,17+,21+/m0/s1 |
| InChIKey | UBYBADRUCVMLSF-NLOUDPMVSA-N |
| XLogP | 3.18 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |