C12H3Br7O — CID 169433966
1,2,3,5-tetrabromo-4-(2,4,5-tribromophenoxy)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (PubChem CID 169433966) has the molecular formula C12H3Br7O and a molecular weight of 728.44 g/mol. Its IUPAC name is 1,2,3,5-tetrabromo-4-(2,4,5-tribromophenoxy)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene.
| Compound Name | 1,2,3,5-tetrabromo-4-(2,4,5-tribromophenoxy)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 169433966 |
| Molecular Formula | C12H3Br7O |
| Molecular Weight | 728.44 g/mol |
| Exact Mass | 721.47 |
| IUPAC Name | 1,2,3,5-tetrabromo-4-(2,4,5-tribromophenoxy)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| SMILES | Brc1cc(Br)c(O[13c]2[13c](Br)[13cH][13c](Br)[13c](Br)[13c]2Br)cc1Br |
| InChI | InChI=1S/C12H3Br7O/c13-4-1-6(15)9(3-5(4)14)20-12-8(17)2-7(16)10(18)11(12)19/h1-3H/i2+1,7+1,8+1,10+1,11+1,12+1 |
| InChIKey | ILPSCQCLBHQUEM-HQRWGFFJSA-N |
| XLogP | 8.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.44 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|