C18H24FN3O3S — CID 169434017
propan-2-yl N-[2,3,4,4,4-pentadeuterio-1-[[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]amino]-1-oxo-3-(trideuteriomethyl)butan-2-yl]carbamate (PubChem CID 169434017) has the molecular formula C18H24FN3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is propan-2-yl N-[2,3,4,4,4-pentadeuterio-1-[[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]amino]-1-oxo-3-(trideuteriomethyl)butan-2-yl]carbamate.
| Compound Name | propan-2-yl N-[2,3,4,4,4-pentadeuterio-1-[[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]amino]-1-oxo-3-(trideuteriomethyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 169434017 |
| Molecular Formula | C18H24FN3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | propan-2-yl N-[2,3,4,4,4-pentadeuterio-1-[[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]amino]-1-oxo-3-(trideuteriomethyl)butan-2-yl]carbamate |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])(NC(=O)OC(C)C)C(=O)N[C@H](C)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C18H24FN3O3S/c1-9(2)15(22-18(24)25-10(3)4)16(23)20-11(5)17-21-13-7-6-12(19)8-14(13)26-17/h6-11,15H,1-5H3,(H,20,23)(H,22,24)/t11-,15?/m1/s1/i1D3,2D3,9D,15D |
| InChIKey | USRKFGIXLGKMKU-UELQKBGPSA-N |
| XLogP | 3.77 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |