C27H31ClN2O6S — CID 169434389
benzenesulfonic acid;4-[4-[(R)-(4-chlorophenyl)-pyridin-2-ylmethoxy]piperidin-1-yl]-2,2,3,3,4,4-hexadeuteriobutanoic acid (PubChem CID 169434389) has the molecular formula C27H31ClN2O6S and a molecular weight of 553.11 g/mol. Its IUPAC name is benzenesulfonic acid;4-[4-[(R)-(4-chlorophenyl)-pyridin-2-ylmethoxy]piperidin-1-yl]-2,2,3,3,4,4-hexadeuteriobutanoic acid.
| Compound Name | benzenesulfonic acid;4-[4-[(R)-(4-chlorophenyl)-pyridin-2-ylmethoxy]piperidin-1-yl]-2,2,3,3,4,4-hexadeuteriobutanoic acid |
|---|---|
| PubChem CID | 169434389 |
| Molecular Formula | C27H31ClN2O6S |
| Molecular Weight | 553.11 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | benzenesulfonic acid;4-[4-[(R)-(4-chlorophenyl)-pyridin-2-ylmethoxy]piperidin-1-yl]-2,2,3,3,4,4-hexadeuteriobutanoic acid |
| SMILES | O=S(=O)(O)c1ccccc1.[2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])N1CCC(O[C@H](c2ccc(Cl)cc2)c2ccccn2)CC1 |
| InChI | InChI=1S/C21H25ClN2O3.C6H6O3S/c22-17-8-6-16(7-9-17)21(19-4-1-2-12-23-19)27-18-10-14-24(15-11-18)13-3-5-20(25)26;7-10(8,9)6-4-2-1-3-5-6/h1-2,4,6-9,12,18,21H,3,5,10-11,13-15H2,(H,25,26);1-5H,(H,7,8,9)/t21-;/m1./s1/i3D2,5D2,13D2; |
| InChIKey | UDGHXQPQKQPSBB-ACGASLLLSA-N |
| XLogP | 5.10 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.11 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|