About 1,1,1-trideuterio-N,N-bis(trimethylsilyl)methanamine
1,1,1-trideuterio-N,N-bis(trimethylsilyl)methanamine (PubChem CID 169434783) has the molecular formula C7H21NSi2
and a molecular weight of 178.44 g/mol. Its IUPAC name is 1,1,1-trideuterio-N,N-bis(trimethylsilyl)methanamine.
Molecular Properties
| Compound Name | 1,1,1-trideuterio-N,N-bis(trimethylsilyl)methanamine |
| PubChem CID | 169434783 |
| Molecular Formula | C7H21NSi2 |
| Molecular Weight | 178.44 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 1,1,1-trideuterio-N,N-bis(trimethylsilyl)methanamine |
| SMILES | [2H]C([2H])([2H])N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C7H21NSi2/c1-8(9(2,3)4)10(5,6)7/h1-7H3/i1D3 |
| InChIKey | ZSMNRKGGHXLZEC-FIBGUPNXSA-N |
| XLogP | 2.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1,1-trideuterio-N,N-bis(trimethylsilyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,1-trideuterio-N,N-bis(trimethylsilyl)methanamine?
The IUPAC name of 1,1,1-trideuterio-N,N-bis(trimethylsilyl)methanamine (CID 169434783) is 1,1,1-trideuterio-N,N-bis(trimethylsilyl)methanamine.
What is the SMILES notation for 1,1,1-trideuterio-N,N-bis(trimethylsilyl)methanamine?
The canonical SMILES for 1,1,1-trideuterio-N,N-bis(trimethylsilyl)methanamine is [2H]C([2H])([2H])N([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of 1,1,1-trideuterio-N,N-bis(trimethylsilyl)methanamine?
The InChIKey is ZSMNRKGGHXLZEC-FIBGUPNXSA-N. The full InChI is InChI=1S/C7H21NSi2/c1-8(9(2,3)4)10(5,6)7/h1-7H3/i1D3.
What are the key properties of 1,1,1-trideuterio-N,N-bis(trimethylsilyl)methanamine?
1,1,1-trideuterio-N,N-bis(trimethylsilyl)methanamine has a molecular weight of 178.44 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,1-trideuterio-N,N-bis(trimethylsilyl)methanamine is sourced from PubChem (CID 169434783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).