About [(3aR)-7-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate
[(3aR)-7-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate (PubChem CID 169434834) has the molecular formula C25H20N2O3
and a molecular weight of 396.45 g/mol. Its IUPAC name is [(3aR)-7-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate.
Molecular Properties
| Compound Name | [(3aR)-7-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate |
| PubChem CID | 169434834 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [(3aR)-7-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate |
| SMILES | Cc1ccc2c(c1)N=C1N(c3ccccc3)CC[C@]1(OC(=O)c1ccccc1)C2=O |
| InChI | InChI=1S/C25H20N2O3/c1-17-12-13-20-21(16-17)26-24-25(22(20)28,30-23(29)18-8-4-2-5-9-18)14-15-27(24)19-10-6-3-7-11-19/h2-13,16H,14-15H2,1H3/t25-/m0/s1 |
| InChIKey | CDSCMODBQMUCFD-VWLOTQADSA-N |
| XLogP | 4.73 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3aR)-7-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3aR)-7-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate?
The IUPAC name of [(3aR)-7-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate (CID 169434834) is [(3aR)-7-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate.
What is the SMILES notation for [(3aR)-7-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate?
The canonical SMILES for [(3aR)-7-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate is Cc1ccc2c(c1)N=C1N(c3ccccc3)CC[C@]1(OC(=O)c1ccccc1)C2=O.
What is the InChIKey of [(3aR)-7-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate?
The InChIKey is CDSCMODBQMUCFD-VWLOTQADSA-N. The full InChI is InChI=1S/C25H20N2O3/c1-17-12-13-20-21(16-17)26-24-25(22(20)28,30-23(29)18-8-4-2-5-9-18)14-15-27(24)19-10-6-3-7-11-19/h2-13,16H,14-15H2,1H3/t25-/m0/s1.
What are the key properties of [(3aR)-7-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate?
[(3aR)-7-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate has a molecular weight of 396.45 g/mol, XLogP of 4.73, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3aR)-7-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate is sourced from PubChem (CID 169434834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).