C20H35BrO3 — CID 169435260
(6E,10E)-2-bromo-2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-ol (PubChem CID 169435260) has the molecular formula C20H35BrO3 and a molecular weight of 403.40 g/mol. Its IUPAC name is (6E,10E)-2-bromo-2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-ol.
| Compound Name | (6E,10E)-2-bromo-2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-ol |
|---|---|
| PubChem CID | 169435260 |
| Molecular Formula | C20H35BrO3 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (6E,10E)-2-bromo-2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-ol |
| SMILES | C/C(=C\COC1CCCCO1)CC/C=C(\C)CCC(O)C(C)(C)Br |
| InChI | InChI=1S/C20H35BrO3/c1-16(11-12-18(22)20(3,4)21)8-7-9-17(2)13-15-24-19-10-5-6-14-23-19/h8,13,18-19,22H,5-7,9-12,14-15H2,1-4H3/b16-8+,17-13+ |
| InChIKey | XLDBOLBWXVJDJP-IUIJUMGXSA-N |
| XLogP | 5.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|