C4H8O — CID 169436874
(1,2,2,3,3-pentadeuteriocyclopropyl)methanol (PubChem CID 169436874) has the molecular formula C4H8O and a molecular weight of 77.14 g/mol. Its IUPAC name is (1,2,2,3,3-pentadeuteriocyclopropyl)methanol.
| Compound Name | (1,2,2,3,3-pentadeuteriocyclopropyl)methanol |
|---|---|
| PubChem CID | 169436874 |
| Molecular Formula | C4H8O |
| Molecular Weight | 77.14 g/mol |
| Exact Mass | 77.09 |
| IUPAC Name | (1,2,2,3,3-pentadeuteriocyclopropyl)methanol |
| SMILES | [2H]C1([2H])C([2H])([2H])C1([2H])CO |
| InChI | InChI=1S/C4H8O/c5-3-4-1-2-4/h4-5H,1-3H2/i1D2,2D2,4D |
| InChIKey | GUDMZGLFZNLYEY-NTCSNYSNSA-N |
| XLogP | 0.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 77.14 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |