C21H25N3O4S — CID 16943758
N-[4-[(2-acetyl-3,4-dihydro-1H-isoquinolin-7-yl)sulfamoyl]phenyl]butanamide (PubChem CID 16943758) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-[4-[(2-acetyl-3,4-dihydro-1H-isoquinolin-7-yl)sulfamoyl]phenyl]butanamide.
| Compound Name | N-[4-[(2-acetyl-3,4-dihydro-1H-isoquinolin-7-yl)sulfamoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 16943758 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N-[4-[(2-acetyl-3,4-dihydro-1H-isoquinolin-7-yl)sulfamoyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(S(=O)(=O)Nc2ccc3c(c2)CN(C(C)=O)CC3)cc1 |
| InChI | InChI=1S/C21H25N3O4S/c1-3-4-21(26)22-18-7-9-20(10-8-18)29(27,28)23-19-6-5-16-11-12-24(15(2)25)14-17(16)13-19/h5-10,13,23H,3-4,11-12,14H2,1-2H3,(H,22,26) |
| InChIKey | XNMDEGMAXZRBNE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |