C28H34N6O4S — CID 169437714
5-[2-ethoxy-5-[4-[(2,3,4,5,6-pentadeuteriophenyl)methyl]piperazin-1-yl]sulfonylphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 169437714) has the molecular formula C28H34N6O4S and a molecular weight of 555.72 g/mol. Its IUPAC name is 5-[2-ethoxy-5-[4-[(2,3,4,5,6-pentadeuteriophenyl)methyl]piperazin-1-yl]sulfonylphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-[2-ethoxy-5-[4-[(2,3,4,5,6-pentadeuteriophenyl)methyl]piperazin-1-yl]sulfonylphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 169437714 |
| Molecular Formula | C28H34N6O4S |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | 5-[2-ethoxy-5-[4-[(2,3,4,5,6-pentadeuteriophenyl)methyl]piperazin-1-yl]sulfonylphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | [2H]c1c([2H])c([2H])c(CN2CCN(S(=O)(=O)c3ccc(OCC)c(-c4nc5c(CCC)nn(C)c5c(=O)[nH]4)c3)CC2)c([2H])c1[2H] |
| InChI | InChI=1S/C28H34N6O4S/c1-4-9-23-25-26(32(3)31-23)28(35)30-27(29-25)22-18-21(12-13-24(22)38-5-2)39(36,37)34-16-14-33(15-17-34)19-20-10-7-6-8-11-20/h6-8,10-13,18H,4-5,9,14-17,19H2,1-3H3,(H,29,30,35)/i6D,7D,8D,10D,11D |
| InChIKey | ZNBBYJQSWODKSY-GUKFMUDKSA-N |
| XLogP | 3.18 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |