C8H5N5O2 — CID 169438676
1,5-dihydropyrimido[1,2-a]purine-6,10-dione (PubChem CID 169438676) has the molecular formula C8H5N5O2 and a molecular weight of 203.16 g/mol. Its IUPAC name is 1,5-dihydropyrimido[1,2-a]purine-6,10-dione.
| Compound Name | 1,5-dihydropyrimido[1,2-a]purine-6,10-dione |
|---|---|
| PubChem CID | 169438676 |
| Molecular Formula | C8H5N5O2 |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 1,5-dihydropyrimido[1,2-a]purine-6,10-dione |
| SMILES | O=c1ccn2c(=O)c3[nH]cnc3nc2[nH]1 |
| InChI | InChI=1S/C8H5N5O2/c14-4-1-2-13-7(15)5-6(10-3-9-5)12-8(13)11-4/h1-3H,(H,9,10)(H,11,12,14) |
| InChIKey | WYCQOKRSTBCXLU-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |