C12H18N2O — CID 169438856
3-[2-(dimethylamino)ethyl]-1,5,6,7-tetrahydroindol-4-one (PubChem CID 169438856) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-1,5,6,7-tetrahydroindol-4-one.
| Compound Name | 3-[2-(dimethylamino)ethyl]-1,5,6,7-tetrahydroindol-4-one |
|---|---|
| PubChem CID | 169438856 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-1,5,6,7-tetrahydroindol-4-one |
| SMILES | CN(C)CCc1c[nH]c2c1C(=O)CCC2 |
| InChI | InChI=1S/C12H18N2O/c1-14(2)7-6-9-8-13-10-4-3-5-11(15)12(9)10/h8,13H,3-7H2,1-2H3 |
| InChIKey | JTELXTOBFAEZKN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |