About (E)-6,6-dimethyl-N-(naphthalen-2-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine
(E)-6,6-dimethyl-N-(naphthalen-2-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine (PubChem CID 169438909) has the molecular formula C21H25N
and a molecular weight of 294.46 g/mol. Its IUPAC name is (E)-6,6-dimethyl-N-(naphthalen-2-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine.
Molecular Properties
| Compound Name | (E)-6,6-dimethyl-N-(naphthalen-2-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine |
| PubChem CID | 169438909 |
| Molecular Formula | C21H25N |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (E)-6,6-dimethyl-N-(naphthalen-2-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine |
| SMILES | [2H]C([2H])([2H])N(C/C=C/C#CC(C)(C)C)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H25N/c1-21(2,3)14-8-5-9-15-22(4)17-18-12-13-19-10-6-7-11-20(19)16-18/h5-7,9-13,16H,15,17H2,1-4H3/b9-5+/i4D3 |
| InChIKey | FMMRYPSASRYXIN-LENGOLOBSA-N |
| XLogP | 4.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-6,6-dimethyl-N-(naphthalen-2-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6,6-dimethyl-N-(naphthalen-2-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine?
The IUPAC name of (E)-6,6-dimethyl-N-(naphthalen-2-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine (CID 169438909) is (E)-6,6-dimethyl-N-(naphthalen-2-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine.
What is the SMILES notation for (E)-6,6-dimethyl-N-(naphthalen-2-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine?
The canonical SMILES for (E)-6,6-dimethyl-N-(naphthalen-2-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine is [2H]C([2H])([2H])N(C/C=C/C#CC(C)(C)C)Cc1ccc2ccccc2c1.
What is the InChIKey of (E)-6,6-dimethyl-N-(naphthalen-2-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine?
The InChIKey is FMMRYPSASRYXIN-LENGOLOBSA-N. The full InChI is InChI=1S/C21H25N/c1-21(2,3)14-8-5-9-15-22(4)17-18-12-13-19-10-6-7-11-20(19)16-18/h5-7,9-13,16H,15,17H2,1-4H3/b9-5+/i4D3.
What are the key properties of (E)-6,6-dimethyl-N-(naphthalen-2-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine?
(E)-6,6-dimethyl-N-(naphthalen-2-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine has a molecular weight of 294.46 g/mol, XLogP of 4.88, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6,6-dimethyl-N-(naphthalen-2-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine is sourced from PubChem (CID 169438909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).