C26H37N3O6 — CID 169439064
N-(2,6-dimethoxyphenyl)-2-[4-[(2R)-2-hydroxy-3-[2-(2-methoxyphenyl)ethoxy]propyl]piperazin-1-yl]acetamide (PubChem CID 169439064) has the molecular formula C26H37N3O6 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-(2,6-dimethoxyphenyl)-2-[4-[(2R)-2-hydroxy-3-[2-(2-methoxyphenyl)ethoxy]propyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2,6-dimethoxyphenyl)-2-[4-[(2R)-2-hydroxy-3-[2-(2-methoxyphenyl)ethoxy]propyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 169439064 |
| Molecular Formula | C26H37N3O6 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | N-(2,6-dimethoxyphenyl)-2-[4-[(2R)-2-hydroxy-3-[2-(2-methoxyphenyl)ethoxy]propyl]piperazin-1-yl]acetamide |
| SMILES | COc1ccccc1CCOC[C@H](O)CN1CCN(CC(=O)Nc2c(OC)cccc2OC)CC1 |
| InChI | InChI=1S/C26H37N3O6/c1-32-22-8-5-4-7-20(22)11-16-35-19-21(30)17-28-12-14-29(15-13-28)18-25(31)27-26-23(33-2)9-6-10-24(26)34-3/h4-10,21,30H,11-19H2,1-3H3,(H,27,31)/t21-/m1/s1 |
| InChIKey | LUCWJHHKPCYBIV-OAQYLSRUSA-N |
| XLogP | 1.89 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|