C9H16Cl2N2O2S — CID 169439331
5-(3,4-diaminothiophen-2-yl)pentanoic acid;dihydrochloride (PubChem CID 169439331) has the molecular formula C9H16Cl2N2O2S and a molecular weight of 287.21 g/mol. Its IUPAC name is 5-(3,4-diaminothiophen-2-yl)pentanoic acid;dihydrochloride.
| Compound Name | 5-(3,4-diaminothiophen-2-yl)pentanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 169439331 |
| Molecular Formula | C9H16Cl2N2O2S |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 5-(3,4-diaminothiophen-2-yl)pentanoic acid;dihydrochloride |
| SMILES | Cl.Cl.Nc1csc(CCCCC(=O)O)c1N |
| InChI | InChI=1S/C9H14N2O2S.2ClH/c10-6-5-14-7(9(6)11)3-1-2-4-8(12)13;;/h5H,1-4,10-11H2,(H,12,13);2*1H |
| InChIKey | QBBFVYQVWDWTOT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|