C6H10O4 — CID 169439479
(1S,2R)-1-[(2S)-(2,3-13C2)oxiran-2-yl]-2-[(2R)-(2,3-13C2)oxiran-2-yl](1,2-13C2)ethane-1,2-diol (PubChem CID 169439479) has the molecular formula C6H10O4 and a molecular weight of 152.10 g/mol. Its IUPAC name is (1S,2R)-1-[(2S)-(2,3-13C2)oxiran-2-yl]-2-[(2R)-(2,3-13C2)oxiran-2-yl](1,2-13C2)ethane-1,2-diol.
| Compound Name | (1S,2R)-1-[(2S)-(2,3-13C2)oxiran-2-yl]-2-[(2R)-(2,3-13C2)oxiran-2-yl](1,2-13C2)ethane-1,2-diol |
|---|---|
| PubChem CID | 169439479 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 152.10 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (1S,2R)-1-[(2S)-(2,3-13C2)oxiran-2-yl]-2-[(2R)-(2,3-13C2)oxiran-2-yl](1,2-13C2)ethane-1,2-diol |
| SMILES | O[13C@H]([13C@H](O)[13C@@H]1[13CH2]O1)[13C@H]1[13CH2]O1 |
| InChI | InChI=1S/C6H10O4/c7-5(3-1-9-3)6(8)4-2-10-4/h3-8H,1-2H2/t3-,4+,5+,6-/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | AAFJXZWCNVJTMK-NYJWAIDYSA-N |
| XLogP | -1.49 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.10 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|