C20H34O2 — CID 169440395
2-[(2E,6E)-3,7-dimethyl-11-(113C)methyl(11,12-13C2)dodeca-2,6,10-trienoxy]oxane (PubChem CID 169440395) has the molecular formula C20H34O2 and a molecular weight of 309.47 g/mol. Its IUPAC name is 2-[(2E,6E)-3,7-dimethyl-11-(113C)methyl(11,12-13C2)dodeca-2,6,10-trienoxy]oxane.
| Compound Name | 2-[(2E,6E)-3,7-dimethyl-11-(113C)methyl(11,12-13C2)dodeca-2,6,10-trienoxy]oxane |
|---|---|
| PubChem CID | 169440395 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | 2-[(2E,6E)-3,7-dimethyl-11-(113C)methyl(11,12-13C2)dodeca-2,6,10-trienoxy]oxane |
| SMILES | C/C(=C\CC/C(C)=C/COC1CCCCO1)CCC=[13C]([13CH3])[13CH3] |
| InChI | InChI=1S/C20H34O2/c1-17(2)9-7-10-18(3)11-8-12-19(4)14-16-22-20-13-5-6-15-21-20/h9,11,14,20H,5-8,10,12-13,15-16H2,1-4H3/b18-11+,19-14+/i1+1,2+1,17+1 |
| InChIKey | XPBIICJUTJFRKE-UULWBMJBSA-N |
| XLogP | 5.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|