C9H12FN — CID 169440641
4-fluoro-N-propan-2-yl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine (PubChem CID 169440641) has the molecular formula C9H12FN and a molecular weight of 159.15 g/mol. Its IUPAC name is 4-fluoro-N-propan-2-yl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine.
| Compound Name | 4-fluoro-N-propan-2-yl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 169440641 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.12 |
| IUPAC Name | 4-fluoro-N-propan-2-yl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine |
| SMILES | CC(C)N[13c]1[13cH][13cH][13c](F)[13cH][13cH]1 |
| InChI | InChI=1S/C9H12FN/c1-7(2)11-9-5-3-8(10)4-6-9/h3-7,11H,1-2H3/i3+1,4+1,5+1,6+1,8+1,9+1 |
| InChIKey | RMXBOQCXULAXBO-CICUYXHZSA-N |
| XLogP | 2.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |