C21H25ClF2O4 — CID 169440690
(6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbonyl chloride (PubChem CID 169440690) has the molecular formula C21H25ClF2O4 and a molecular weight of 414.88 g/mol. Its IUPAC name is (6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbonyl chloride.
| Compound Name | (6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbonyl chloride |
|---|---|
| PubChem CID | 169440690 |
| Molecular Formula | C21H25ClF2O4 |
| Molecular Weight | 414.88 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbonyl chloride |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)Cl |
| InChI | InChI=1S/C21H25ClF2O4/c1-10-6-12-13-8-15(23)14-7-11(25)4-5-18(14,2)20(13,24)16(26)9-19(12,3)21(10,28)17(22)27/h4-5,7,10,12-13,15-16,26,28H,6,8-9H2,1-3H3/t10-,12+,13+,15+,16+,18+,19+,20+,21+/m1/s1 |
| InChIKey | DGNMWVKGJGKDSS-IDIDPBNYSA-N |
| XLogP | 3.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.88 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|