C15H23N5O2S — CID 169441065
2-methylsulfanyl-5-nitro-4-N,6-N-bis(3,3,4,4-tetradeuteriocyclopentyl)pyrimidine-4,6-diamine (PubChem CID 169441065) has the molecular formula C15H23N5O2S and a molecular weight of 345.50 g/mol. Its IUPAC name is 2-methylsulfanyl-5-nitro-4-N,6-N-bis(3,3,4,4-tetradeuteriocyclopentyl)pyrimidine-4,6-diamine.
| Compound Name | 2-methylsulfanyl-5-nitro-4-N,6-N-bis(3,3,4,4-tetradeuteriocyclopentyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 169441065 |
| Molecular Formula | C15H23N5O2S |
| Molecular Weight | 345.50 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 2-methylsulfanyl-5-nitro-4-N,6-N-bis(3,3,4,4-tetradeuteriocyclopentyl)pyrimidine-4,6-diamine |
| SMILES | [2H]C1([2H])CC(Nc2nc(SC)nc(NC3CC([2H])([2H])C([2H])([2H])C3)c2[N+](=O)[O-])CC1([2H])[2H] |
| InChI | InChI=1S/C15H23N5O2S/c1-23-15-18-13(16-10-6-2-3-7-10)12(20(21)22)14(19-15)17-11-8-4-5-9-11/h10-11H,2-9H2,1H3,(H2,16,17,18,19)/i2D2,3D2,4D2,5D2 |
| InChIKey | GSGVDKOCBKBMGG-UDCOFZOWSA-N |
| XLogP | 3.82 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|