C9H4Cl3IO — CID 169441114
1,2,4-trichloro-5-(3-iodoprop-2-ynoxy)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (PubChem CID 169441114) has the molecular formula C9H4Cl3IO and a molecular weight of 367.35 g/mol. Its IUPAC name is 1,2,4-trichloro-5-(3-iodoprop-2-ynoxy)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene.
| Compound Name | 1,2,4-trichloro-5-(3-iodoprop-2-ynoxy)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 169441114 |
| Molecular Formula | C9H4Cl3IO |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 365.86 |
| IUPAC Name | 1,2,4-trichloro-5-(3-iodoprop-2-ynoxy)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| SMILES | Cl[13c]1[13cH][13c](Cl)[13c](OCC#CI)[13cH][13c]1Cl |
| InChI | InChI=1S/C9H4Cl3IO/c10-6-4-8(12)9(5-7(6)11)14-3-1-2-13/h4-5H,3H2/i4+1,5+1,6+1,7+1,8+1,9+1 |
| InChIKey | CTETYYAZBPJBHE-VFESMUGCSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|