C20H32O4 — CID 169441186
(5Z,8Z,10S)-10-hydroxy-10-[(2S,3S)-3-[(Z)-4,4,5,5,6,6,7,7,8,8,8-undecadeuteriooct-2-enyl]oxiran-2-yl]deca-5,8-dienoic acid (PubChem CID 169441186) has the molecular formula C20H32O4 and a molecular weight of 347.54 g/mol. Its IUPAC name is (5Z,8Z,10S)-10-hydroxy-10-[(2S,3S)-3-[(Z)-4,4,5,5,6,6,7,7,8,8,8-undecadeuteriooct-2-enyl]oxiran-2-yl]deca-5,8-dienoic acid.
| Compound Name | (5Z,8Z,10S)-10-hydroxy-10-[(2S,3S)-3-[(Z)-4,4,5,5,6,6,7,7,8,8,8-undecadeuteriooct-2-enyl]oxiran-2-yl]deca-5,8-dienoic acid |
|---|---|
| PubChem CID | 169441186 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.30 |
| IUPAC Name | (5Z,8Z,10S)-10-hydroxy-10-[(2S,3S)-3-[(Z)-4,4,5,5,6,6,7,7,8,8,8-undecadeuteriooct-2-enyl]oxiran-2-yl]deca-5,8-dienoic acid |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])/C=C\C[C@@H]1O[C@H]1[C@@H](O)/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-9-12-15-18-20(24-18)17(21)14-11-8-6-7-10-13-16-19(22)23/h6-7,9,11-12,14,17-18,20-21H,2-5,8,10,13,15-16H2,1H3,(H,22,23)/b7-6-,12-9-,14-11-/t17-,18-,20-/m0/s1/i1D3,2D2,3D2,4D2,5D2 |
| InChIKey | DWNBPRRXEVJMPO-IZYQWECMSA-N |
| XLogP | 4.40 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|