C12H4Br6O — CID 169441227
1,2,3-tribromo-4-(3,4,6-tribromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxybenzene (PubChem CID 169441227) has the molecular formula C12H4Br6O and a molecular weight of 649.54 g/mol. Its IUPAC name is 1,2,3-tribromo-4-(3,4,6-tribromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxybenzene.
| Compound Name | 1,2,3-tribromo-4-(3,4,6-tribromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxybenzene |
|---|---|
| PubChem CID | 169441227 |
| Molecular Formula | C12H4Br6O |
| Molecular Weight | 649.54 g/mol |
| Exact Mass | 643.56 |
| IUPAC Name | 1,2,3-tribromo-4-(3,4,6-tribromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxybenzene |
| SMILES | Brc1ccc(O[13c]2[13cH][13c](Br)[13c](Br)[13cH][13c]2Br)c(Br)c1Br |
| InChI | InChI=1S/C12H4Br6O/c13-5-1-2-9(12(18)11(5)17)19-10-4-7(15)6(14)3-8(10)16/h1-4H/i3+1,4+1,6+1,7+1,8+1,10+1 |
| InChIKey | IZFQCEZFGCMHOM-BUAWHRFHSA-N |
| XLogP | 8.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.54 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|