C13H26NO4+ — CID 169441256
[(2R)-3-carboxy-2-(6,6,6-trideuteriohexanoyloxy)propyl]-trimethylazanium (PubChem CID 169441256) has the molecular formula C13H26NO4+ and a molecular weight of 263.37 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-(6,6,6-trideuteriohexanoyloxy)propyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-(6,6,6-trideuteriohexanoyloxy)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 169441256 |
| Molecular Formula | C13H26NO4+ |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | [(2R)-3-carboxy-2-(6,6,6-trideuteriohexanoyloxy)propyl]-trimethylazanium |
| SMILES | [2H]C([2H])([2H])CCCCC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C13H25NO4/c1-5-6-7-8-13(17)18-11(9-12(15)16)10-14(2,3)4/h11H,5-10H2,1-4H3/p+1/t11-/m1/s1/i1D3 |
| InChIKey | VVPRQWTYSNDTEA-KMKPOHAJSA-O |
| XLogP | 1.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|