C20H18N2O3S2 — CID 16944267
N-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)thiophene-2-sulfonamide (PubChem CID 16944267) has the molecular formula C20H18N2O3S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)thiophene-2-sulfonamide.
| Compound Name | N-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 16944267 |
| Molecular Formula | C20H18N2O3S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)thiophene-2-sulfonamide |
| SMILES | O=C(c1ccccc1)N1CCc2ccc(NS(=O)(=O)c3cccs3)cc2C1 |
| InChI | InChI=1S/C20H18N2O3S2/c23-20(16-5-2-1-3-6-16)22-11-10-15-8-9-18(13-17(15)14-22)21-27(24,25)19-7-4-12-26-19/h1-9,12-13,21H,10-11,14H2 |
| InChIKey | WKMRUGMGHXUXEO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |