C25H34O6 — CID 169443042
(1S,2S,4R,8S,9S,11S,12S,13R,14S,18R)-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-propyl-5,7-dioxahexacyclo[10.8.0.02,9.04,8.013,18.014,18]icos-16-en-15-one (PubChem CID 169443042) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is (1S,2S,4R,8S,9S,11S,12S,13R,14S,18R)-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-propyl-5,7-dioxahexacyclo[10.8.0.02,9.04,8.013,18.014,18]icos-16-en-15-one.
| Compound Name | (1S,2S,4R,8S,9S,11S,12S,13R,14S,18R)-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-propyl-5,7-dioxahexacyclo[10.8.0.02,9.04,8.013,18.014,18]icos-16-en-15-one |
|---|---|
| PubChem CID | 169443042 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (1S,2S,4R,8S,9S,11S,12S,13R,14S,18R)-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-propyl-5,7-dioxahexacyclo[10.8.0.02,9.04,8.013,18.014,18]icos-16-en-15-one |
| SMILES | CCCC1O[C@@H]2C[C@H]3[C@@H]4CC[C@@]56C=CC(=O)[C@H]5[C@@]6(C)[C@H]4[C@@H](O)C[C@]3(C)[C@]2(C(=O)CO)O1 |
| InChI | InChI=1S/C25H34O6/c1-4-5-19-30-18-10-14-13-6-8-24-9-7-15(27)21(24)23(24,3)20(13)16(28)11-22(14,2)25(18,31-19)17(29)12-26/h7,9,13-14,16,18-21,26,28H,4-6,8,10-12H2,1-3H3/t13-,14-,16-,18+,19?,20+,21-,22-,23+,24+,25+/m0/s1 |
| InChIKey | KMHCNEHPJWAGON-DWNNTZEESA-N |
| XLogP | 2.41 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |