C13H17NO4 — CID 169443910
(2R)-2-[[(E)-4-methoxy-4-oxobut-2-en-2-yl]amino]-2-(2,3,4,5,6-pentadeuteriocyclohexa-1,4-dien-1-yl)acetic acid (PubChem CID 169443910) has the molecular formula C13H17NO4 and a molecular weight of 256.31 g/mol. Its IUPAC name is (2R)-2-[[(E)-4-methoxy-4-oxobut-2-en-2-yl]amino]-2-(2,3,4,5,6-pentadeuteriocyclohexa-1,4-dien-1-yl)acetic acid.
| Compound Name | (2R)-2-[[(E)-4-methoxy-4-oxobut-2-en-2-yl]amino]-2-(2,3,4,5,6-pentadeuteriocyclohexa-1,4-dien-1-yl)acetic acid |
|---|---|
| PubChem CID | 169443910 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (2R)-2-[[(E)-4-methoxy-4-oxobut-2-en-2-yl]amino]-2-(2,3,4,5,6-pentadeuteriocyclohexa-1,4-dien-1-yl)acetic acid |
| SMILES | [2H]C1=C([2H])C([2H])C([C@@H](N/C(C)=C/C(=O)OC)C(=O)O)=C([2H])C1[2H] |
| InChI | InChI=1S/C13H17NO4/c1-9(8-11(15)18-2)14-12(13(16)17)10-6-4-3-5-7-10/h3-4,7-8,12,14H,5-6H2,1-2H3,(H,16,17)/b9-8+/t12-/m1/s1/i3D,4D,5D,6D,7D/t5?,6?,12- |
| InChIKey | KLSJALAGRWLJNT-MYWDCIMWSA-N |
| XLogP | 1.38 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|