C5H6N2OS — CID 169443936
6-(113C)methyl-2-sulfanylidene-(4,5,6-13C3)1H-pyrimidin-4-one (PubChem CID 169443936) has the molecular formula C5H6N2OS and a molecular weight of 146.15 g/mol. Its IUPAC name is 6-(113C)methyl-2-sulfanylidene-(4,5,6-13C3)1H-pyrimidin-4-one.
| Compound Name | 6-(113C)methyl-2-sulfanylidene-(4,5,6-13C3)1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 169443936 |
| Molecular Formula | C5H6N2OS |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.03 |
| IUPAC Name | 6-(113C)methyl-2-sulfanylidene-(4,5,6-13C3)1H-pyrimidin-4-one |
| SMILES | [13CH3][13c]1[13cH][13c](=O)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C5H6N2OS/c1-3-2-4(8)7-5(9)6-3/h2H,1H3,(H2,6,7,8,9)/i1+1,2+1,3+1,4+1 |
| InChIKey | HWGBHCRJGXAGEU-JCDJMFQYSA-N |
| XLogP | 0.74 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|