About (6R)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-ol
(6R)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-ol (PubChem CID 169444104) has the molecular formula C8H10OS2
and a molecular weight of 186.30 g/mol. Its IUPAC name is (6R)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-ol.
Molecular Properties
| Compound Name | (6R)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-ol |
| PubChem CID | 169444104 |
| Molecular Formula | C8H10OS2 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | (6R)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-ol |
| SMILES | C[C@@H]1CC(O)c2ccsc2S1 |
| InChI | InChI=1S/C8H10OS2/c1-5-4-7(9)6-2-3-10-8(6)11-5/h2-3,5,7,9H,4H2,1H3/t5-,7?/m1/s1 |
| InChIKey | RSJUYFIZTAZAEA-FOUAAFFMSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6R)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-ol?
The IUPAC name of (6R)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-ol (CID 169444104) is (6R)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-ol.
What is the SMILES notation for (6R)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-ol?
The canonical SMILES for (6R)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-ol is C[C@@H]1CC(O)c2ccsc2S1.
What is the InChIKey of (6R)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-ol?
The InChIKey is RSJUYFIZTAZAEA-FOUAAFFMSA-N. The full InChI is InChI=1S/C8H10OS2/c1-5-4-7(9)6-2-3-10-8(6)11-5/h2-3,5,7,9H,4H2,1H3/t5-,7?/m1/s1.
What are the key properties of (6R)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-ol?
(6R)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-ol has a molecular weight of 186.30 g/mol, XLogP of 2.67, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-ol is sourced from PubChem (CID 169444104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).