C22H26ClF2NO4 — CID 169444641
2-[[2-hydroxy-2-(3,3,4,4-tetradeuterio-6-fluoro-2H-chromen-2-yl)ethyl]amino]-1-(3,3,4,4-tetradeuterio-6-fluoro-2H-chromen-2-yl)ethanol;hydrochloride (PubChem CID 169444641) has the molecular formula C22H26ClF2NO4 and a molecular weight of 449.95 g/mol. Its IUPAC name is 2-[[2-hydroxy-2-(3,3,4,4-tetradeuterio-6-fluoro-2H-chromen-2-yl)ethyl]amino]-1-(3,3,4,4-tetradeuterio-6-fluoro-2H-chromen-2-yl)ethanol;hydrochloride.
| Compound Name | 2-[[2-hydroxy-2-(3,3,4,4-tetradeuterio-6-fluoro-2H-chromen-2-yl)ethyl]amino]-1-(3,3,4,4-tetradeuterio-6-fluoro-2H-chromen-2-yl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 169444641 |
| Molecular Formula | C22H26ClF2NO4 |
| Molecular Weight | 449.95 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-[[2-hydroxy-2-(3,3,4,4-tetradeuterio-6-fluoro-2H-chromen-2-yl)ethyl]amino]-1-(3,3,4,4-tetradeuterio-6-fluoro-2H-chromen-2-yl)ethanol;hydrochloride |
| SMILES | Cl.[2H]C1([2H])c2cc(F)ccc2OC(C(O)CNCC(O)C2Oc3ccc(F)cc3C([2H])([2H])C2([2H])[2H])C1([2H])[2H] |
| InChI | InChI=1S/C22H25F2NO4.ClH/c23-15-3-7-19-13(9-15)1-5-21(28-19)17(26)11-25-12-18(27)22-6-2-14-10-16(24)4-8-20(14)29-22;/h3-4,7-10,17-18,21-22,25-27H,1-2,5-6,11-12H2;1H/i1D2,2D2,5D2,6D2; |
| InChIKey | JWEXHQAEWHKGCW-ZSYWKFBFSA-N |
| XLogP | 2.79 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.95 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |