C23H31NO4S — CID 169444932
N-[6-[(6aR,10aR)-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]hex-4-ynyl]-1,1,1-trideuterio(113C)methanesulfonamide (PubChem CID 169444932) has the molecular formula C23H31NO4S and a molecular weight of 421.58 g/mol. Its IUPAC name is N-[6-[(6aR,10aR)-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]hex-4-ynyl]-1,1,1-trideuterio(113C)methanesulfonamide.
| Compound Name | N-[6-[(6aR,10aR)-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]hex-4-ynyl]-1,1,1-trideuterio(113C)methanesulfonamide |
|---|---|
| PubChem CID | 169444932 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | N-[6-[(6aR,10aR)-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]hex-4-ynyl]-1,1,1-trideuterio(113C)methanesulfonamide |
| SMILES | [2H][13C]([2H])([2H])S(=O)(=O)NCCCC#CCc1cc(O)c2c(c1)OC(C)(C)[C@@H]1CC=C(C)C[C@@H]21 |
| InChI | InChI=1S/C23H31NO4S/c1-16-10-11-19-18(13-16)22-20(25)14-17(15-21(22)28-23(19,2)3)9-7-5-6-8-12-24-29(4,26)27/h10,14-15,18-19,24-25H,6,8-9,11-13H2,1-4H3/t18-,19-/m1/s1/i4+1D3 |
| InChIKey | DJTGGIYZQHHLGJ-CKRLNKEMSA-N |
| XLogP | 3.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|