C14H10N2O3S2 — CID 169445189
3-[4-hydroxy-5-(2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]propanal (PubChem CID 169445189) has the molecular formula C14H10N2O3S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 3-[4-hydroxy-5-(2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]propanal.
| Compound Name | 3-[4-hydroxy-5-(2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]propanal |
|---|---|
| PubChem CID | 169445189 |
| Molecular Formula | C14H10N2O3S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 3-[4-hydroxy-5-(2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]propanal |
| SMILES | O=CCCn1c(O)c(C2=c3ccccc3=NC2=O)sc1=S |
| InChI | InChI=1S/C14H10N2O3S2/c17-7-3-6-16-13(19)11(21-14(16)20)10-8-4-1-2-5-9(8)15-12(10)18/h1-2,4-5,7,19H,3,6H2 |
| InChIKey | HYQMMBCEZHEBDN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|