C25H21FNNaO4 — CID 169446474
sodium (3R,5S)-5-(6-cyclopropyl-10-fluorobenzo[k]phenanthridin-8-yl)-3,5-dihydroxypentanoate (PubChem CID 169446474) has the molecular formula C25H21FNNaO4 and a molecular weight of 441.43 g/mol. Its IUPAC name is sodium (3R,5S)-5-(6-cyclopropyl-10-fluorobenzo[k]phenanthridin-8-yl)-3,5-dihydroxypentanoate.
| Compound Name | sodium (3R,5S)-5-(6-cyclopropyl-10-fluorobenzo[k]phenanthridin-8-yl)-3,5-dihydroxypentanoate |
|---|---|
| PubChem CID | 169446474 |
| Molecular Formula | C25H21FNNaO4 |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | sodium (3R,5S)-5-(6-cyclopropyl-10-fluorobenzo[k]phenanthridin-8-yl)-3,5-dihydroxypentanoate |
| SMILES | O=C([O-])C[C@H](O)C[C@H](O)c1cc2c(C3CC3)nc3ccccc3c2c2ccc(F)cc12.[Na+] |
| InChI | InChI=1S/C25H22FNO4.Na/c26-14-7-8-16-18(9-14)19(22(29)10-15(28)11-23(30)31)12-20-24(16)17-3-1-2-4-21(17)27-25(20)13-5-6-13;/h1-4,7-9,12-13,15,22,28-29H,5-6,10-11H2,(H,30,31);/q;+1/p-1/t15-,22+;/m1./s1 |
| InChIKey | XZPFMVDCGZBIAB-GYOOIPBJSA-M |
| XLogP | 0.49 |
| TPSA | 93.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|