C20H24FN4NaO3 — CID 169446654
sodium (Z)-2-(2-amino-5-fluorophenyl)-3-[4-[2-(dimethylamino)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]prop-2-enoate (PubChem CID 169446654) has the molecular formula C20H24FN4NaO3 and a molecular weight of 410.43 g/mol. Its IUPAC name is sodium (Z)-2-(2-amino-5-fluorophenyl)-3-[4-[2-(dimethylamino)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]prop-2-enoate.
| Compound Name | sodium (Z)-2-(2-amino-5-fluorophenyl)-3-[4-[2-(dimethylamino)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 169446654 |
| Molecular Formula | C20H24FN4NaO3 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | sodium (Z)-2-(2-amino-5-fluorophenyl)-3-[4-[2-(dimethylamino)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]prop-2-enoate |
| SMILES | Cc1[nH]c(/C=C(\C(=O)[O-])c2cc(F)ccc2N)c(C)c1C(=O)NCCN(C)C.[Na+] |
| InChI | InChI=1S/C20H25FN4O3.Na/c1-11-17(24-12(2)18(11)19(26)23-7-8-25(3)4)10-15(20(27)28)14-9-13(21)5-6-16(14)22;/h5-6,9-10,24H,7-8,22H2,1-4H3,(H,23,26)(H,27,28);/q;+1/p-1/b15-10-; |
| InChIKey | CGYZRFOLVBZNRK-AZJSCORLSA-M |
| XLogP | -2.06 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|