C37H28IN3S — CID 169447167
3-methyl-2-[(E)-2-[4-(1,4,5-triphenylimidazol-2-yl)phenyl]ethenyl]-1,3-benzothiazol-3-ium iodide (PubChem CID 169447167) has the molecular formula C37H28IN3S and a molecular weight of 673.62 g/mol. Its IUPAC name is 3-methyl-2-[(E)-2-[4-(1,4,5-triphenylimidazol-2-yl)phenyl]ethenyl]-1,3-benzothiazol-3-ium iodide.
| Compound Name | 3-methyl-2-[(E)-2-[4-(1,4,5-triphenylimidazol-2-yl)phenyl]ethenyl]-1,3-benzothiazol-3-ium iodide |
|---|---|
| PubChem CID | 169447167 |
| Molecular Formula | C37H28IN3S |
| Molecular Weight | 673.62 g/mol |
| Exact Mass | 673.10 |
| IUPAC Name | 3-methyl-2-[(E)-2-[4-(1,4,5-triphenylimidazol-2-yl)phenyl]ethenyl]-1,3-benzothiazol-3-ium iodide |
| SMILES | C[n+]1c(/C=C/c2ccc(-c3nc(-c4ccccc4)c(-c4ccccc4)n3-c3ccccc3)cc2)sc2ccccc21.[I-] |
| InChI | InChI=1S/C37H28N3S.HI/c1-39-32-19-11-12-20-33(32)41-34(39)26-23-27-21-24-30(25-22-27)37-38-35(28-13-5-2-6-14-28)36(29-15-7-3-8-16-29)40(37)31-17-9-4-10-18-31;/h2-26H,1H3;1H/q+1;/p-1 |
| InChIKey | QXPPKQJVOAEDSY-UHFFFAOYSA-M |
| XLogP | 6.09 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|