C11H12O5 — CID 169447527
3-hydroxy-5-oxo-4-(1,2,2,3,3-pentadeuteriocyclopropanecarbonyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 169447527) has the molecular formula C11H12O5 and a molecular weight of 229.24 g/mol. Its IUPAC name is 3-hydroxy-5-oxo-4-(1,2,2,3,3-pentadeuteriocyclopropanecarbonyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 3-hydroxy-5-oxo-4-(1,2,2,3,3-pentadeuteriocyclopropanecarbonyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 169447527 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 3-hydroxy-5-oxo-4-(1,2,2,3,3-pentadeuteriocyclopropanecarbonyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | [2H]C1([2H])C([2H])([2H])C1([2H])C(=O)C1=C(O)CC(C(=O)O)CC1=O |
| InChI | InChI=1S/C11H12O5/c12-7-3-6(11(15)16)4-8(13)9(7)10(14)5-1-2-5/h5-6,12H,1-4H2,(H,15,16)/i1D2,2D2,5D |
| InChIKey | VBCTWYYWENEQCX-QJWYSIDNSA-N |
| XLogP | 0.84 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|