C16H16O2 — CID 169447724
5,6,7,8-tetradeuterio-2-(3-methylbut-2-enyl)-3-(trideuteriomethyl)naphthalene-1,4-dione (PubChem CID 169447724) has the molecular formula C16H16O2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 5,6,7,8-tetradeuterio-2-(3-methylbut-2-enyl)-3-(trideuteriomethyl)naphthalene-1,4-dione.
| Compound Name | 5,6,7,8-tetradeuterio-2-(3-methylbut-2-enyl)-3-(trideuteriomethyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 169447724 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 5,6,7,8-tetradeuterio-2-(3-methylbut-2-enyl)-3-(trideuteriomethyl)naphthalene-1,4-dione |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])C(=O)C(CC=C(C)C)=C(C([2H])([2H])[2H])C2=O |
| InChI | InChI=1S/C16H16O2/c1-10(2)8-9-12-11(3)15(17)13-6-4-5-7-14(13)16(12)18/h4-8H,9H2,1-3H3/i3D3,4D,5D,6D,7D |
| InChIKey | ABSPRNADVQNDOU-WBEXQYSESA-N |
| XLogP | 3.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|