C15H24 — CID 169447739
(2R,8R,8aS)-4,4,5,6,6,7,7-heptadeuterio-8,8a-dimethyl-2-prop-1-en-2-yl-1,2,3,8-tetrahydronaphthalene (PubChem CID 169447739) has the molecular formula C15H24 and a molecular weight of 211.40 g/mol. Its IUPAC name is (2R,8R,8aS)-4,4,5,6,6,7,7-heptadeuterio-8,8a-dimethyl-2-prop-1-en-2-yl-1,2,3,8-tetrahydronaphthalene.
| Compound Name | (2R,8R,8aS)-4,4,5,6,6,7,7-heptadeuterio-8,8a-dimethyl-2-prop-1-en-2-yl-1,2,3,8-tetrahydronaphthalene |
|---|---|
| PubChem CID | 169447739 |
| Molecular Formula | C15H24 |
| Molecular Weight | 211.40 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | (2R,8R,8aS)-4,4,5,6,6,7,7-heptadeuterio-8,8a-dimethyl-2-prop-1-en-2-yl-1,2,3,8-tetrahydronaphthalene |
| SMILES | [2H]C1=C2C([2H])([2H])C[C@@H](C(=C)C)C[C@@]2(C)[C@H](C)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h7,12-13H,1,5-6,8-10H2,2-4H3/t12-,13-,15+/m1/s1/i5D2,6D2,7D,9D2 |
| InChIKey | QEBNYNLSCGVZOH-RCYSFBGBSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|