C14H18N4O5S — CID 169448129
6a-methyl-3-(2-methylphenyl)-6-nitro-4,4-dioxo-3,3a,5,6-tetrahydro-2H-thieno[3,2-c]pyrazole-1-carboxamide (PubChem CID 169448129) has the molecular formula C14H18N4O5S and a molecular weight of 354.39 g/mol. Its IUPAC name is 6a-methyl-3-(2-methylphenyl)-6-nitro-4,4-dioxo-3,3a,5,6-tetrahydro-2H-thieno[3,2-c]pyrazole-1-carboxamide.
| Compound Name | 6a-methyl-3-(2-methylphenyl)-6-nitro-4,4-dioxo-3,3a,5,6-tetrahydro-2H-thieno[3,2-c]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 169448129 |
| Molecular Formula | C14H18N4O5S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 6a-methyl-3-(2-methylphenyl)-6-nitro-4,4-dioxo-3,3a,5,6-tetrahydro-2H-thieno[3,2-c]pyrazole-1-carboxamide |
| SMILES | Cc1ccccc1C1NN(C(N)=O)C2(C)C([N+](=O)[O-])CS(=O)(=O)C12 |
| InChI | InChI=1S/C14H18N4O5S/c1-8-5-3-4-6-9(8)11-12-14(2,17(16-11)13(15)19)10(18(20)21)7-24(12,22)23/h3-6,10-12,16H,7H2,1-2H3,(H2,15,19) |
| InChIKey | RUICNAOSVYQAFN-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|