C54H84O2 — CID 169448216
2,2,3,3,4a,5,5,6,6-nonakis(3-methylbut-2-enyl)-7H-chromen-4-one (PubChem CID 169448216) has the molecular formula C54H84O2 and a molecular weight of 765.26 g/mol. Its IUPAC name is 2,2,3,3,4a,5,5,6,6-nonakis(3-methylbut-2-enyl)-7H-chromen-4-one.
| Compound Name | 2,2,3,3,4a,5,5,6,6-nonakis(3-methylbut-2-enyl)-7H-chromen-4-one |
|---|---|
| PubChem CID | 169448216 |
| Molecular Formula | C54H84O2 |
| Molecular Weight | 765.26 g/mol |
| Exact Mass | 764.65 |
| IUPAC Name | 2,2,3,3,4a,5,5,6,6-nonakis(3-methylbut-2-enyl)-7H-chromen-4-one |
| SMILES | CC(C)=CCC1(CC=C(C)C)CC=C2OC(CC=C(C)C)(CC=C(C)C)C(CC=C(C)C)(CC=C(C)C)C(=O)C2(CC=C(C)C)C1(CC=C(C)C)CC=C(C)C |
| InChI | InChI=1S/C54H84O2/c1-39(2)19-29-50(30-20-40(3)4)31-28-48-54(38-27-47(17)18,52(50,34-23-43(9)10)35-24-44(11)12)49(55)51(32-21-41(5)6,33-22-42(7)8)53(56-48,36-25-45(13)14)37-26-46(15)16/h19-28H,29-38H2,1-18H3 |
| InChIKey | NLIONVVRLFXLPA-UHFFFAOYSA-N |
| XLogP | 16.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.26 |
| LogP ≤ 5 | 16.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|